About 3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol
3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol (PubChem CID 130143918) has the molecular formula C9H12O2S
and a molecular weight of 184.26 g/mol. Its IUPAC name is 3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol.
Analyze 3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol?
The IUPAC name of 3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol (CID 130143918) is 3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol.
What is the SMILES notation for 3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol?
The canonical SMILES for 3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol is Cc1csc2c1C(O)C(O)CC2.
What is the InChIKey of 3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol?
The InChIKey is GANJEYAVSOBKEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2S/c1-5-4-12-7-3-2-6(10)9(11)8(5)7/h4,6,9-11H,2-3H2,1H3.
What are the key properties of 3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol?
3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol has a molecular weight of 184.26 g/mol, XLogP of 1.40, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4,5,6,7-tetrahydro-1-benzothiophene-4,5-diol is sourced from PubChem (CID 130143918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).