C10H11I — CID 142165770
9-methyl-2λ3-iodabicyclo[4.4.0]deca-1(6),2,4,7-tetraene (PubChem CID 142165770) has the molecular formula C10H11I and a molecular weight of 258.10 g/mol. Its IUPAC name is 9-methyl-2λ3-iodabicyclo[4.4.0]deca-1(6),2,4,7-tetraene.
| Compound Name | 9-methyl-2λ3-iodabicyclo[4.4.0]deca-1(6),2,4,7-tetraene |
|---|---|
| PubChem CID | 142165770 |
| Molecular Formula | C10H11I |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 9-methyl-2λ3-iodabicyclo[4.4.0]deca-1(6),2,4,7-tetraene |
| SMILES | CC1C=CC2=C(C1)I=CC=C2 |
| InChI | InChI=1S/C10H11I/c1-8-4-5-9-3-2-6-11-10(9)7-8/h2-6,8H,7H2,1H3 |
| InChIKey | MJPFNKFOKLXQNL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|