C17H28 — CID 165090077
bicyclo[2.2.1]hepta-2,5-diene;(3Z)-3-ethylidene-5-methylcyclopentene;methane (PubChem CID 165090077) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-2,5-diene;(3Z)-3-ethylidene-5-methylcyclopentene;methane.
| Compound Name | bicyclo[2.2.1]hepta-2,5-diene;(3Z)-3-ethylidene-5-methylcyclopentene;methane |
|---|---|
| PubChem CID | 165090077 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | bicyclo[2.2.1]hepta-2,5-diene;(3Z)-3-ethylidene-5-methylcyclopentene;methane |
| SMILES | C.C.C/C=C1\C=CC(C)C1.C1=CC2C=CC1C2 |
| InChI | InChI=1S/C8H12.C7H8.2CH4/c1-3-8-5-4-7(2)6-8;1-2-7-4-3-6(1)5-7;;/h3-5,7H,6H2,1-2H3;1-4,6-7H,5H2;2*1H4/b8-3+;;; |
| InChIKey | WNXLRZWTRANSSV-UYDUTXMUSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|