C15H18 — CID 167623145
bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene (PubChem CID 167623145) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene.
| Compound Name | bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene |
|---|---|
| PubChem CID | 167623145 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene |
| SMILES | C1=CC2C=CC1C2.C1=CC2C=CC1CC2 |
| InChI | InChI=1S/C8H10.C7H8/c1-2-8-5-3-7(1)4-6-8;1-2-7-4-3-6(1)5-7/h1-3,5,7-8H,4,6H2;1-4,6-7H,5H2 |
| InChIKey | MSJDMLWTUOHASD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|