About bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene
bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene (PubChem CID 167623145) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene |
| PubChem CID | 167623145 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene |
| SMILES | C1=CC2C=CC1C2.C1=CC2C=CC1CC2 |
| InChI | InChI=1S/C8H10.C7H8/c1-2-8-5-3-7(1)4-6-8;1-2-7-4-3-6(1)5-7/h1-3,5,7-8H,4,6H2;1-4,6-7H,5H2 |
| InChIKey | MSJDMLWTUOHASD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene?
The IUPAC name of bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene (CID 167623145) is bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene.
What is the SMILES notation for bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene?
The canonical SMILES for bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene is C1=CC2C=CC1C2.C1=CC2C=CC1CC2.
What is the InChIKey of bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene?
The InChIKey is MSJDMLWTUOHASD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C7H8/c1-2-8-5-3-7(1)4-6-8;1-2-7-4-3-6(1)5-7/h1-3,5,7-8H,4,6H2;1-4,6-7H,5H2.
What are the key properties of bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene?
bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene has a molecular weight of 198.31 g/mol, XLogP of 3.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hepta-2,5-diene;bicyclo[2.2.2]octa-2,5-diene is sourced from PubChem (CID 167623145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).