C22H38 — CID 157423842
bicyclo[2.2.1]hepta-2,5-diene;methane;tricyclo[6.2.1.02,7]undeca-4,9-diene (PubChem CID 157423842) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-2,5-diene;methane;tricyclo[6.2.1.02,7]undeca-4,9-diene.
| Compound Name | bicyclo[2.2.1]hepta-2,5-diene;methane;tricyclo[6.2.1.02,7]undeca-4,9-diene |
|---|---|
| PubChem CID | 157423842 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | bicyclo[2.2.1]hepta-2,5-diene;methane;tricyclo[6.2.1.02,7]undeca-4,9-diene |
| SMILES | C.C.C.C.C1=CC2C=CC1C2.C1=CCC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C11H14.C7H8.4CH4/c1-2-4-11-9-6-5-8(7-9)10(11)3-1;1-2-7-4-3-6(1)5-7;;;;/h1-2,5-6,8-11H,3-4,7H2;1-4,6-7H,5H2;4*1H4 |
| InChIKey | BPSODHPGTJYAAY-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|