C11H12MoO4+4 — CID 170920471
bicyclo[2.2.1]hepta-2,5-diene;methylidyneoxidanium;molybdenum (PubChem CID 170920471) has the molecular formula C11H12MoO4+4 and a molecular weight of 304.15 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-2,5-diene;methylidyneoxidanium;molybdenum.
| Compound Name | bicyclo[2.2.1]hepta-2,5-diene;methylidyneoxidanium;molybdenum |
|---|---|
| PubChem CID | 170920471 |
| Molecular Formula | C11H12MoO4+4 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | bicyclo[2.2.1]hepta-2,5-diene;methylidyneoxidanium;molybdenum |
| SMILES | C#[O+].C#[O+].C#[O+].C#[O+].C1=CC2C=CC1C2.[Mo] |
| InChI | InChI=1S/C7H8.4CHO.Mo/c1-2-7-4-3-6(1)5-7;4*1-2;/h1-4,6-7H,5H2;4*1H;/q;4*+1; |
| InChIKey | MOPASTFEKLPOOX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 79.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|