C15H20 — CID 159756335
bicyclo[2.2.1]hepta-2,5-diene;3-ethenyl-5-methylcyclopentene (PubChem CID 159756335) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-2,5-diene;3-ethenyl-5-methylcyclopentene.
| Compound Name | bicyclo[2.2.1]hepta-2,5-diene;3-ethenyl-5-methylcyclopentene |
|---|---|
| PubChem CID | 159756335 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | bicyclo[2.2.1]hepta-2,5-diene;3-ethenyl-5-methylcyclopentene |
| SMILES | C1=CC2C=CC1C2.C=CC1C=CC(C)C1 |
| InChI | InChI=1S/C8H12.C7H8/c1-3-8-5-4-7(2)6-8;1-2-7-4-3-6(1)5-7/h3-5,7-8H,1,6H2,2H3;1-4,6-7H,5H2 |
| InChIKey | NEHSHFFHOGACME-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|