C21H40 — CID 157050513
3,5-dimethylcyclopentene;(Z)-3-methylhex-3-ene;(E)-3-methylhex-3-ene (PubChem CID 157050513) has the molecular formula C21H40 and a molecular weight of 292.55 g/mol. Its IUPAC name is 3,5-dimethylcyclopentene;(Z)-3-methylhex-3-ene;(E)-3-methylhex-3-ene.
| Compound Name | 3,5-dimethylcyclopentene;(Z)-3-methylhex-3-ene;(E)-3-methylhex-3-ene |
|---|---|
| PubChem CID | 157050513 |
| Molecular Formula | C21H40 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | 3,5-dimethylcyclopentene;(Z)-3-methylhex-3-ene;(E)-3-methylhex-3-ene |
| SMILES | CC/C=C(/C)CC.CC/C=C(\C)CC.CC1C=CC(C)C1 |
| InChI | InChI=1S/C7H12.2C7H14/c1-6-3-4-7(2)5-6;2*1-4-6-7(3)5-2/h3-4,6-7H,5H2,1-2H3;2*6H,4-5H2,1-3H3/b;7-6+;7-6- |
| InChIKey | AADMFMBRQBQPST-OUYYKFNVSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|