C17H26 — CID 54543469
5-(2-ethylidene-5-methylhept-4-enyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 54543469) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 5-(2-ethylidene-5-methylhept-4-enyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(2-ethylidene-5-methylhept-4-enyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 54543469 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 5-(2-ethylidene-5-methylhept-4-enyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | CC=C(CC=C(C)CC)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C17H26/c1-4-13(3)6-7-14(5-2)10-17-12-15-8-9-16(17)11-15/h5-6,8-9,15-17H,4,7,10-12H2,1-3H3 |
| InChIKey | ZEWTYKGKODPHIN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|