C25H38 — CID 59970599
5-[(Z,2Z)-2-ethylidene-3,3,4,4,5,6-hexamethyldec-5-en-9-ynyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 59970599) has the molecular formula C25H38 and a molecular weight of 338.58 g/mol. Its IUPAC name is 5-[(Z,2Z)-2-ethylidene-3,3,4,4,5,6-hexamethyldec-5-en-9-ynyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-[(Z,2Z)-2-ethylidene-3,3,4,4,5,6-hexamethyldec-5-en-9-ynyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 59970599 |
| Molecular Formula | C25H38 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | 5-[(Z,2Z)-2-ethylidene-3,3,4,4,5,6-hexamethyldec-5-en-9-ynyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | C#CCC/C(C)=C(/C)C(C)(C)C(C)(C)/C(=C\C)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C25H38/c1-9-11-12-18(3)19(4)24(5,6)25(7,8)23(10-2)17-22-16-20-13-14-21(22)15-20/h1,10,13-14,20-22H,11-12,15-17H2,2-8H3/b19-18-,23-10- |
| InChIKey | PRXBJQLFTOEJJQ-BRBHNEPWSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|