C12H16FP — CID 143018982
[(3E)-3-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-fluorobuta-1,3-dien-2-yl]phosphane (PubChem CID 143018982) has the molecular formula C12H16FP and a molecular weight of 210.23 g/mol. Its IUPAC name is [(3E)-3-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-fluorobuta-1,3-dien-2-yl]phosphane.
| Compound Name | [(3E)-3-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-fluorobuta-1,3-dien-2-yl]phosphane |
|---|---|
| PubChem CID | 143018982 |
| Molecular Formula | C12H16FP |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | [(3E)-3-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-fluorobuta-1,3-dien-2-yl]phosphane |
| SMILES | C=C(P)/C(=C/F)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C12H16FP/c1-8(14)12(7-13)6-11-5-9-2-3-10(11)4-9/h2-3,7,9-11H,1,4-6,14H2/b12-7+ |
| InChIKey | AXFZPNHXEOBXHN-KPKJPENVSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|