C9H12O — CID 130146867
bicyclo[3.2.2]nona-3,6-dien-2-ol (PubChem CID 130146867) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is bicyclo[3.2.2]nona-3,6-dien-2-ol.
| Compound Name | bicyclo[3.2.2]nona-3,6-dien-2-ol |
|---|---|
| PubChem CID | 130146867 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | bicyclo[3.2.2]nona-3,6-dien-2-ol |
| SMILES | OC1C=CC2C=CC1CC2 |
| InChI | InChI=1S/C9H12O/c10-9-6-3-7-1-4-8(9)5-2-7/h1,3-4,6-10H,2,5H2 |
| InChIKey | HYZSZYOUVKGGPC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|