C10H12O — CID 130125118
bicyclo[3.3.2]deca-3,7,9-trien-2-ol (PubChem CID 130125118) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is bicyclo[3.3.2]deca-3,7,9-trien-2-ol.
| Compound Name | bicyclo[3.3.2]deca-3,7,9-trien-2-ol |
|---|---|
| PubChem CID | 130125118 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | bicyclo[3.3.2]deca-3,7,9-trien-2-ol |
| SMILES | OC1C=CC2C=CC1C=CC2 |
| InChI | InChI=1S/C10H12O/c11-10-7-5-8-2-1-3-9(10)6-4-8/h1,3-11H,2H2 |
| InChIKey | AMGHQMFPAFGEIZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|