C10H12O3 — CID 130122909
5-hydroxy-4-oxatricyclo[5.2.2.02,6]undec-8-en-3-one (PubChem CID 130122909) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 5-hydroxy-4-oxatricyclo[5.2.2.02,6]undec-8-en-3-one.
| Compound Name | 5-hydroxy-4-oxatricyclo[5.2.2.02,6]undec-8-en-3-one |
|---|---|
| PubChem CID | 130122909 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 5-hydroxy-4-oxatricyclo[5.2.2.02,6]undec-8-en-3-one |
| SMILES | O=C1OC(O)C2C3C=CC(CC3)C12 |
| InChI | InChI=1S/C10H12O3/c11-9-7-5-1-2-6(4-3-5)8(7)10(12)13-9/h1-2,5-9,11H,3-4H2 |
| InChIKey | PTYOYRGZSMCSEK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|