C10H11NO3 — CID 150448346
5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide (PubChem CID 150448346) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide.
| Compound Name | 5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
|---|---|
| PubChem CID | 150448346 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
| SMILES | NC(=O)C1OC(=O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C10H11NO3/c11-9(12)8-6-4-1-2-5(3-4)7(6)10(13)14-8/h1-2,4-8H,3H2,(H2,11,12) |
| InChIKey | HNGBKXNPVXWYRV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|