C33H30N2O4 — CID 3601440
4-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methyl]phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 3601440) has the molecular formula C33H30N2O4 and a molecular weight of 518.61 g/mol. Its IUPAC name is 4-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methyl]phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | 4-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methyl]phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 3601440 |
| Molecular Formula | C33H30N2O4 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 4-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methyl]phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(CC3)C2C(=O)N1c1ccc(Cc2ccc(N3C(=O)C4C5C=CC(CC5)C4C3=O)cc2)cc1 |
| InChI | InChI=1S/C33H30N2O4/c36-30-26-20-5-6-21(8-7-20)27(26)31(37)34(30)24-13-1-18(2-14-24)17-19-3-15-25(16-4-19)35-32(38)28-22-9-10-23(12-11-22)29(28)33(35)39/h1-6,9-10,13-16,20-23,26-29H,7-8,11-12,17H2 |
| InChIKey | XEDYPXCGWPPZID-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|