C25H31N3O3 — CID 66491090
N-[[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methyl]-2,6-dimethylpiperidine-1-carboxamide (PubChem CID 66491090) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methyl]-2,6-dimethylpiperidine-1-carboxamide.
| Compound Name | N-[[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methyl]-2,6-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 66491090 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-[[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl]methyl]-2,6-dimethylpiperidine-1-carboxamide |
| SMILES | CC1CCCC(C)N1C(=O)NCc1ccc(N2C(=O)C3C4C=CC(CC4)C3C2=O)cc1 |
| InChI | InChI=1S/C25H31N3O3/c1-15-4-3-5-16(2)27(15)25(31)26-14-17-6-12-20(13-7-17)28-23(29)21-18-8-9-19(11-10-18)22(21)24(28)30/h6-9,12-13,15-16,18-19,21-22H,3-5,10-11,14H2,1-2H3,(H,26,31) |
| InChIKey | DTVNXZZDJAFHLZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|