C39H42N2O4 — CID 162203371
bis(but-1-ene);4-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 162203371) has the molecular formula C39H42N2O4 and a molecular weight of 602.78 g/mol. Its IUPAC name is bis(but-1-ene);4-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | bis(but-1-ene);4-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 162203371 |
| Molecular Formula | C39H42N2O4 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | bis(but-1-ene);4-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]methyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C=CCC.C=CCC.O=C1C2C3C=CC(C3)C2C(=O)N1c1ccc(Cc2ccc(N3C(=O)C4C5C=CC(C5)C4C3=O)cc2)cc1 |
| InChI | InChI=1S/C31H26N2O4.2C4H8/c34-28-24-18-5-6-19(14-18)25(24)29(35)32(28)22-9-1-16(2-10-22)13-17-3-11-23(12-4-17)33-30(36)26-20-7-8-21(15-20)27(26)31(33)37;2*1-3-4-2/h1-12,18-21,24-27H,13-15H2;2*3H,1,4H2,2H3 |
| InChIKey | ZRWJAIUQGYEVDE-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|