C36H40N2O2 — CID 170099002
2-[4-[[4-(4-ethenyl-6-methyl-1,3-dimethylidene-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)phenyl]methyl]phenyl]-4-ethyl-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 170099002) has the molecular formula C36H40N2O2 and a molecular weight of 532.73 g/mol. Its IUPAC name is 2-[4-[[4-(4-ethenyl-6-methyl-1,3-dimethylidene-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)phenyl]methyl]phenyl]-4-ethyl-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[4-[[4-(4-ethenyl-6-methyl-1,3-dimethylidene-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)phenyl]methyl]phenyl]-4-ethyl-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 170099002 |
| Molecular Formula | C36H40N2O2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | 2-[4-[[4-(4-ethenyl-6-methyl-1,3-dimethylidene-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)phenyl]methyl]phenyl]-4-ethyl-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C=CC1CC(C)C2C(=C)N(c3ccc(Cc4ccc(N5C(=O)C6C(C)C=CC(CC)C6C5=O)cc4)cc3)C(=C)C12 |
| InChI | InChI=1S/C36H40N2O2/c1-7-27-14-9-21(3)32-34(27)36(40)38(35(32)39)30-17-12-26(13-18-30)20-25-10-15-29(16-11-25)37-23(5)31-22(4)19-28(8-2)33(31)24(37)6/h8-18,21-22,27-28,31-34H,2,5-7,19-20H2,1,3-4H3 |
| InChIKey | MQPRDHKCCLKSFI-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|