C7H9ClS — CID 141163660
4-chloro-5-methylcyclohexa-2,4-diene-1-thiol (PubChem CID 141163660) has the molecular formula C7H9ClS and a molecular weight of 160.67 g/mol. Its IUPAC name is 4-chloro-5-methylcyclohexa-2,4-diene-1-thiol.
| Compound Name | 4-chloro-5-methylcyclohexa-2,4-diene-1-thiol |
|---|---|
| PubChem CID | 141163660 |
| Molecular Formula | C7H9ClS |
| Molecular Weight | 160.67 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 4-chloro-5-methylcyclohexa-2,4-diene-1-thiol |
| SMILES | CC1=C(Cl)C=CC(S)C1 |
| InChI | InChI=1S/C7H9ClS/c1-5-4-6(9)2-3-7(5)8/h2-3,6,9H,4H2,1H3 |
| InChIKey | LPDZOTFPAJVBCJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|