C9H11Cl — CID 123998921
1-chloro-4,7-dimethylcyclohepta-1,3,5-triene (PubChem CID 123998921) has the molecular formula C9H11Cl and a molecular weight of 154.64 g/mol. Its IUPAC name is 1-chloro-4,7-dimethylcyclohepta-1,3,5-triene.
| Compound Name | 1-chloro-4,7-dimethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 123998921 |
| Molecular Formula | C9H11Cl |
| Molecular Weight | 154.64 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 1-chloro-4,7-dimethylcyclohepta-1,3,5-triene |
| SMILES | CC1=CC=C(Cl)C(C)C=C1 |
| InChI | InChI=1S/C9H11Cl/c1-7-3-5-8(2)9(10)6-4-7/h3-6,8H,1-2H3 |
| InChIKey | QBXLEOHMIRHIJU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.64 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |