C12H14 — CID 58813834
1,4,5-trimethyl-1H-indene (PubChem CID 58813834) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 1,4,5-trimethyl-1H-indene.
| Compound Name | 1,4,5-trimethyl-1H-indene |
|---|---|
| PubChem CID | 58813834 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 1,4,5-trimethyl-1H-indene |
| SMILES | Cc1ccc2c(c1C)C=CC2C |
| InChI | InChI=1S/C12H14/c1-8-4-6-11-9(2)5-7-12(11)10(8)3/h4-7,9H,1-3H3 |
| InChIKey | CYOWIFMPHXDOHC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |