About (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene
(1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene (PubChem CID 18720350) has the molecular formula C24H26
and a molecular weight of 314.47 g/mol. Its IUPAC name is (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene.
Molecular Properties
| Compound Name | (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene |
| PubChem CID | 18720350 |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene |
| SMILES | Cc1ccc(CCc2ccc(C)c3c2C=C[C@@H]3C)c2c1[C@H](C)C=C2 |
| InChI | InChI=1S/C24H26/c1-15-5-9-19(21-13-7-17(3)23(15)21)11-12-20-10-6-16(2)24-18(4)8-14-22(20)24/h5-10,13-14,17-18H,11-12H2,1-4H3/t17-,18+ |
| InChIKey | IXVTZDDXSNENON-HDICACEKSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene?
The IUPAC name of (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene (CID 18720350) is (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene.
What is the SMILES notation for (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene?
The canonical SMILES for (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene is Cc1ccc(CCc2ccc(C)c3c2C=C[C@@H]3C)c2c1[C@H](C)C=C2.
What is the InChIKey of (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene?
The InChIKey is IXVTZDDXSNENON-HDICACEKSA-N. The full InChI is InChI=1S/C24H26/c1-15-5-9-19(21-13-7-17(3)23(15)21)11-12-20-10-6-16(2)24-18(4)8-14-22(20)24/h5-10,13-14,17-18H,11-12H2,1-4H3/t17-,18+.
What are the key properties of (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene?
(1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene has a molecular weight of 314.47 g/mol, XLogP of 6.35, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-4-[2-[(1R)-1,7-dimethyl-1H-inden-4-yl]ethyl]-1,7-dimethyl-1H-indene is sourced from PubChem (CID 18720350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).