About lithium;1,5-dimethyl-1H-indene;hydride
lithium;1,5-dimethyl-1H-indene;hydride (PubChem CID 175183172) has the molecular formula C11H13Li
and a molecular weight of 152.17 g/mol. Its IUPAC name is lithium;1,5-dimethyl-1H-indene;hydride.
Molecular Properties
| Compound Name | lithium;1,5-dimethyl-1H-indene;hydride |
| PubChem CID | 175183172 |
| Molecular Formula | C11H13Li |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | lithium;1,5-dimethyl-1H-indene;hydride |
| SMILES | Cc1ccc2c(c1)C=CC2C.[H-].[Li+] |
| InChI | InChI=1S/C11H12.Li.H/c1-8-3-6-11-9(2)4-5-10(11)7-8;;/h3-7,9H,1-2H3;;/q;+1;-1 |
| InChIKey | HFKPNYIMZHJWIO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze lithium;1,5-dimethyl-1H-indene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1,5-dimethyl-1H-indene;hydride?
The IUPAC name of lithium;1,5-dimethyl-1H-indene;hydride (CID 175183172) is lithium;1,5-dimethyl-1H-indene;hydride.
What is the SMILES notation for lithium;1,5-dimethyl-1H-indene;hydride?
The canonical SMILES for lithium;1,5-dimethyl-1H-indene;hydride is Cc1ccc2c(c1)C=CC2C.[H-].[Li+].
What is the InChIKey of lithium;1,5-dimethyl-1H-indene;hydride?
The InChIKey is HFKPNYIMZHJWIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12.Li.H/c1-8-3-6-11-9(2)4-5-10(11)7-8;;/h3-7,9H,1-2H3;;/q;+1;-1.
What are the key properties of lithium;1,5-dimethyl-1H-indene;hydride?
lithium;1,5-dimethyl-1H-indene;hydride has a molecular weight of 152.17 g/mol, XLogP of 0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1,5-dimethyl-1H-indene;hydride is sourced from PubChem (CID 175183172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).