C29H39N3 — CID 143589409
1,5-dimethyl-1H-indene;3-[5-methyl-4-[(E)-C-methyl-N-(prop-1-en-2-ylamino)carbonimidoyl]-2-propan-2-ylphenyl]prop-1-en-2-amine (PubChem CID 143589409) has the molecular formula C29H39N3 and a molecular weight of 429.65 g/mol. Its IUPAC name is 1,5-dimethyl-1H-indene;3-[5-methyl-4-[(E)-C-methyl-N-(prop-1-en-2-ylamino)carbonimidoyl]-2-propan-2-ylphenyl]prop-1-en-2-amine.
| Compound Name | 1,5-dimethyl-1H-indene;3-[5-methyl-4-[(E)-C-methyl-N-(prop-1-en-2-ylamino)carbonimidoyl]-2-propan-2-ylphenyl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 143589409 |
| Molecular Formula | C29H39N3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | 1,5-dimethyl-1H-indene;3-[5-methyl-4-[(E)-C-methyl-N-(prop-1-en-2-ylamino)carbonimidoyl]-2-propan-2-ylphenyl]prop-1-en-2-amine |
| SMILES | C=C(N)Cc1cc(C)c(/C(C)=N/NC(=C)C)cc1C(C)C.Cc1ccc2c(c1)C=CC2C |
| InChI | InChI=1S/C18H27N3.C11H12/c1-11(2)17-10-18(15(7)21-20-12(3)4)13(5)8-16(17)9-14(6)19;1-8-3-6-11-9(2)4-5-10(11)7-8/h8,10-11,20H,3,6,9,19H2,1-2,4-5,7H3;3-7,9H,1-2H3/b21-15+; |
| InChIKey | KBQXSGSCTBXBQJ-NEMIEIFKSA-N |
| XLogP | 7.11 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|