C17H20N2O2 — CID 123707880
2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide (PubChem CID 123707880) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide.
| Compound Name | 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 123707880 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide |
| SMILES | C=C(/N=C(\N)c1ccc(C)cc1C)C(=C)C(=O)CC(C)=O |
| InChI | InChI=1S/C17H20N2O2/c1-10-6-7-15(11(2)8-10)17(18)19-14(5)13(4)16(21)9-12(3)20/h6-8H,4-5,9H2,1-3H3,(H2,18,19) |
| InChIKey | YVYITJBWADQOFM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|