About 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide
2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide (PubChem CID 123707880) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide.
Molecular Properties
| Compound Name | 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide |
| PubChem CID | 123707880 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide |
| SMILES | C=C(/N=C(\N)c1ccc(C)cc1C)C(=C)C(=O)CC(C)=O |
| InChI | InChI=1S/C17H20N2O2/c1-10-6-7-15(11(2)8-10)17(18)19-14(5)13(4)16(21)9-12(3)20/h6-8H,4-5,9H2,1-3H3,(H2,18,19) |
| InChIKey | YVYITJBWADQOFM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide?
The IUPAC name of 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide (CID 123707880) is 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide.
What is the SMILES notation for 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide?
The canonical SMILES for 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide is C=C(/N=C(\N)c1ccc(C)cc1C)C(=C)C(=O)CC(C)=O.
What is the InChIKey of 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide?
The InChIKey is YVYITJBWADQOFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2/c1-10-6-7-15(11(2)8-10)17(18)19-14(5)13(4)16(21)9-12(3)20/h6-8H,4-5,9H2,1-3H3,(H2,18,19).
What are the key properties of 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide?
2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide has a molecular weight of 284.36 g/mol, XLogP of 2.63, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-N'-(3-methylidene-4,6-dioxohept-1-en-2-yl)benzenecarboximidamide is sourced from PubChem (CID 123707880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).