C16H21N — CID 121342877
(1Z,3Z)-5-(2,4-dimethylphenyl)-N,2-dimethylhexa-1,3,5-trien-1-amine (PubChem CID 121342877) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (1Z,3Z)-5-(2,4-dimethylphenyl)-N,2-dimethylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-5-(2,4-dimethylphenyl)-N,2-dimethylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 121342877 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (1Z,3Z)-5-(2,4-dimethylphenyl)-N,2-dimethylhexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=C\C(C)=C/NC)c1ccc(C)cc1C |
| InChI | InChI=1S/C16H21N/c1-12-7-9-16(15(4)10-12)14(3)8-6-13(2)11-17-5/h6-11,17H,3H2,1-2,4-5H3/b8-6-,13-11- |
| InChIKey | LKUVKQBXUJWYRC-MJQGXCIASA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|