C21H24O — CID 89138571
1-[(1E)-3-(2,4-dimethylphenyl)-1-methoxybuta-1,3-dienyl]-2,4-dimethylbenzene (PubChem CID 89138571) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-[(1E)-3-(2,4-dimethylphenyl)-1-methoxybuta-1,3-dienyl]-2,4-dimethylbenzene.
| Compound Name | 1-[(1E)-3-(2,4-dimethylphenyl)-1-methoxybuta-1,3-dienyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 89138571 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-[(1E)-3-(2,4-dimethylphenyl)-1-methoxybuta-1,3-dienyl]-2,4-dimethylbenzene |
| SMILES | C=C(/C=C(/OC)c1ccc(C)cc1C)c1ccc(C)cc1C |
| InChI | InChI=1S/C21H24O/c1-14-7-9-19(16(3)11-14)18(5)13-21(22-6)20-10-8-15(2)12-17(20)4/h7-13H,5H2,1-4,6H3/b21-13+ |
| InChIKey | UDUKXICJPQEDCY-FYJGNVAPSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|