C6H6Cl2 — CID 54281076
1,6-dichlorocyclohexa-1,4-diene (PubChem CID 54281076) has the molecular formula C6H6Cl2 and a molecular weight of 149.02 g/mol. Its IUPAC name is 1,6-dichlorocyclohexa-1,4-diene.
| Compound Name | 1,6-dichlorocyclohexa-1,4-diene |
|---|---|
| PubChem CID | 54281076 |
| Molecular Formula | C6H6Cl2 |
| Molecular Weight | 149.02 g/mol |
| Exact Mass | 147.98 |
| IUPAC Name | 1,6-dichlorocyclohexa-1,4-diene |
| SMILES | ClC1=CCC=CC1Cl |
| InChI | InChI=1S/C6H6Cl2/c7-5-3-1-2-4-6(5)8/h1,3-5H,2H2 |
| InChIKey | INEIYYZNWSIXAZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.02 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|