C22H24ClNO2S — CID 174595839
4-(2-chlorocyclohexa-2,5-dien-1-yl)-1-(4-methylnaphthalen-1-yl)sulfonylpiperidine (PubChem CID 174595839) has the molecular formula C22H24ClNO2S and a molecular weight of 401.96 g/mol. Its IUPAC name is 4-(2-chlorocyclohexa-2,5-dien-1-yl)-1-(4-methylnaphthalen-1-yl)sulfonylpiperidine.
| Compound Name | 4-(2-chlorocyclohexa-2,5-dien-1-yl)-1-(4-methylnaphthalen-1-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 174595839 |
| Molecular Formula | C22H24ClNO2S |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 4-(2-chlorocyclohexa-2,5-dien-1-yl)-1-(4-methylnaphthalen-1-yl)sulfonylpiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C3C=CCC=C3Cl)CC2)c2ccccc12 |
| InChI | InChI=1S/C22H24ClNO2S/c1-16-10-11-22(20-8-3-2-6-18(16)20)27(25,26)24-14-12-17(13-15-24)19-7-4-5-9-21(19)23/h2-4,6-11,17,19H,5,12-15H2,1H3 |
| InChIKey | UCTUPMFQWYPBLG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|