C18H21ClFNO2S — CID 174517692
1-(3-chloro-2-methylphenyl)sulfonyl-4-(2-fluorocyclohexa-2,5-dien-1-yl)piperidine (PubChem CID 174517692) has the molecular formula C18H21ClFNO2S and a molecular weight of 369.89 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)sulfonyl-4-(2-fluorocyclohexa-2,5-dien-1-yl)piperidine.
| Compound Name | 1-(3-chloro-2-methylphenyl)sulfonyl-4-(2-fluorocyclohexa-2,5-dien-1-yl)piperidine |
|---|---|
| PubChem CID | 174517692 |
| Molecular Formula | C18H21ClFNO2S |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)sulfonyl-4-(2-fluorocyclohexa-2,5-dien-1-yl)piperidine |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CCC(C2C=CCC=C2F)CC1 |
| InChI | InChI=1S/C18H21ClFNO2S/c1-13-16(19)6-4-8-18(13)24(22,23)21-11-9-14(10-12-21)15-5-2-3-7-17(15)20/h2,4-8,14-15H,3,9-12H2,1H3 |
| InChIKey | BMPXDMMOYDXCET-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|