C19H23BrClNO2S — CID 174503509
4-(2-bromocyclohexa-2,5-dien-1-yl)-1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidine (PubChem CID 174503509) has the molecular formula C19H23BrClNO2S and a molecular weight of 444.82 g/mol. Its IUPAC name is 4-(2-bromocyclohexa-2,5-dien-1-yl)-1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidine.
| Compound Name | 4-(2-bromocyclohexa-2,5-dien-1-yl)-1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 174503509 |
| Molecular Formula | C19H23BrClNO2S |
| Molecular Weight | 444.82 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 4-(2-bromocyclohexa-2,5-dien-1-yl)-1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidine |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(C3C=CCC=C3Br)CC2)c(C)cc1Cl |
| InChI | InChI=1S/C19H23BrClNO2S/c1-13-12-19(14(2)11-18(13)21)25(23,24)22-9-7-15(8-10-22)16-5-3-4-6-17(16)20/h3,5-6,11-12,15-16H,4,7-10H2,1-2H3 |
| InChIKey | SGIBVRSHFABFLR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.82 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|