C18H18BrF3N2O4S — CID 174517754
4-(2-bromocyclohexa-2,5-dien-1-yl)-1-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpiperidine (PubChem CID 174517754) has the molecular formula C18H18BrF3N2O4S and a molecular weight of 495.32 g/mol. Its IUPAC name is 4-(2-bromocyclohexa-2,5-dien-1-yl)-1-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpiperidine.
| Compound Name | 4-(2-bromocyclohexa-2,5-dien-1-yl)-1-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 174517754 |
| Molecular Formula | C18H18BrF3N2O4S |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 4-(2-bromocyclohexa-2,5-dien-1-yl)-1-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpiperidine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1S(=O)(=O)N1CCC(C2C=CCC=C2Br)CC1 |
| InChI | InChI=1S/C18H18BrF3N2O4S/c19-15-4-2-1-3-14(15)12-7-9-23(10-8-12)29(27,28)17-6-5-13(18(20,21)22)11-16(17)24(25)26/h1,3-6,11-12,14H,2,7-10H2 |
| InChIKey | OVAAVKWFCHKWCY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|