C23H21F3N2O5S — CID 90749709
8a-benzyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfonyl-3,5,7,8-tetrahydro-1H-isoquinolin-6-one (PubChem CID 90749709) has the molecular formula C23H21F3N2O5S and a molecular weight of 494.49 g/mol. Its IUPAC name is 8a-benzyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfonyl-3,5,7,8-tetrahydro-1H-isoquinolin-6-one.
| Compound Name | 8a-benzyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfonyl-3,5,7,8-tetrahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 90749709 |
| Molecular Formula | C23H21F3N2O5S |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 8a-benzyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfonyl-3,5,7,8-tetrahydro-1H-isoquinolin-6-one |
| SMILES | O=C1CCC2(Cc3ccccc3)CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC=C2C1 |
| InChI | InChI=1S/C23H21F3N2O5S/c24-23(25,26)18-6-7-21(20(13-18)28(30)31)34(32,33)27-11-9-17-12-19(29)8-10-22(17,15-27)14-16-4-2-1-3-5-16/h1-7,9,13H,8,10-12,14-15H2 |
| InChIKey | PZLJSPLSLBJEFW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|