C20H23ClF3N3O4S — CID 21092251
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-nitro-4-(trifluoromethyl)benzenesulfonamide;hydrochloride (PubChem CID 21092251) has the molecular formula C20H23ClF3N3O4S and a molecular weight of 493.94 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-nitro-4-(trifluoromethyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-nitro-4-(trifluoromethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 21092251 |
| Molecular Formula | C20H23ClF3N3O4S |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-nitro-4-(trifluoromethyl)benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc(C(F)(F)F)ccc1S(=O)(=O)NCCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H22F3N3O4S.ClH/c21-20(22,23)17-7-8-19(18(13-17)26(27)28)31(29,30)24-10-3-4-11-25-12-9-15-5-1-2-6-16(15)14-25;/h1-2,5-8,13,24H,3-4,9-12,14H2;1H |
| InChIKey | FYEBNCFELHXLKS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|