C25H29N3O4S — CID 58859279
4-methyl-N-[5-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]naphthalene-1-sulfonamide (PubChem CID 58859279) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is 4-methyl-N-[5-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]naphthalene-1-sulfonamide.
| Compound Name | 4-methyl-N-[5-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 58859279 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 4-methyl-N-[5-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]naphthalene-1-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCCN2CCc3ccc([N+](=O)[O-])cc3C2)c2ccccc12 |
| InChI | InChI=1S/C25H29N3O4S/c1-19-9-12-25(24-8-4-3-7-23(19)24)33(31,32)26-14-5-2-6-15-27-16-13-20-10-11-22(28(29)30)17-21(20)18-27/h3-4,7-12,17,26H,2,5-6,13-16,18H2,1H3 |
| InChIKey | YOFCGHQNONWCKB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|