C20H24BrN3O5S — CID 21092197
5-bromo-2-methoxy-N-[4-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]benzenesulfonamide (PubChem CID 21092197) has the molecular formula C20H24BrN3O5S and a molecular weight of 498.40 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[4-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-[4-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 21092197 |
| Molecular Formula | C20H24BrN3O5S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 5-bromo-2-methoxy-N-[4-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NCCCCN1CCc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C20H24BrN3O5S/c1-29-19-7-5-17(21)13-20(19)30(27,28)22-9-2-3-10-23-11-8-15-4-6-18(24(25)26)12-16(15)14-23/h4-7,12-13,22H,2-3,8-11,14H2,1H3 |
| InChIKey | WREFRKHCCXHSIW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|