C19H21Cl4N3O4S — CID 21091996
2,4,5-trichloro-N-[4-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]benzenesulfonamide;hydrochloride (PubChem CID 21091996) has the molecular formula C19H21Cl4N3O4S and a molecular weight of 529.27 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[4-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]benzenesulfonamide;hydrochloride.
| Compound Name | 2,4,5-trichloro-N-[4-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 21091996 |
| Molecular Formula | C19H21Cl4N3O4S |
| Molecular Weight | 529.27 g/mol |
| Exact Mass | 527.00 |
| IUPAC Name | 2,4,5-trichloro-N-[4-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)butyl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2c(c1)CN(CCCCNS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl)CC2 |
| InChI | InChI=1S/C19H20Cl3N3O4S.ClH/c20-16-10-18(22)19(11-17(16)21)30(28,29)23-6-1-2-7-24-8-5-13-3-4-15(25(26)27)9-14(13)12-24;/h3-4,9-11,23H,1-2,5-8,12H2;1H |
| InChIKey | KPDUHBNGWACHEP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|