C23H31ClN2O2S — CID 58859286
4-chloro-N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)hexyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 58859286) has the molecular formula C23H31ClN2O2S and a molecular weight of 435.03 g/mol. Its IUPAC name is 4-chloro-N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)hexyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)hexyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 58859286 |
| Molecular Formula | C23H31ClN2O2S |
| Molecular Weight | 435.03 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-chloro-N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)hexyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCCCCN2CCc3ccccc3C2)c(C)cc1Cl |
| InChI | InChI=1S/C23H31ClN2O2S/c1-18-16-23(19(2)15-22(18)24)29(27,28)25-12-7-3-4-8-13-26-14-11-20-9-5-6-10-21(20)17-26/h5-6,9-10,15-16,25H,3-4,7-8,11-14,17H2,1-2H3 |
| InChIKey | CIUWGUDNWRGWPL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.03 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|