C23H29ClN2O2S — CID 11684213
N-[4-(5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)butyl]-4-chloro-2,5-dimethylbenzenesulfonamide (PubChem CID 11684213) has the molecular formula C23H29ClN2O2S and a molecular weight of 433.02 g/mol. Its IUPAC name is N-[4-(5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)butyl]-4-chloro-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[4-(5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)butyl]-4-chloro-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 11684213 |
| Molecular Formula | C23H29ClN2O2S |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[4-(5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)butyl]-4-chloro-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCCN2CCc3cccc4c3C2CC4)c(C)cc1Cl |
| InChI | InChI=1S/C23H29ClN2O2S/c1-16-15-22(17(2)14-20(16)24)29(27,28)25-11-3-4-12-26-13-10-19-7-5-6-18-8-9-21(26)23(18)19/h5-7,14-15,21,25H,3-4,8-13H2,1-2H3 |
| InChIKey | MTTLULIHMJLHOH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|