C22H26Cl4N2O4S — CID 67359417
2,4,5-trichloro-N-[3-(10,11-dimethoxy-5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)propyl]benzenesulfonamide;hydrochloride (PubChem CID 67359417) has the molecular formula C22H26Cl4N2O4S and a molecular weight of 556.34 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[3-(10,11-dimethoxy-5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)propyl]benzenesulfonamide;hydrochloride.
| Compound Name | 2,4,5-trichloro-N-[3-(10,11-dimethoxy-5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)propyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 67359417 |
| Molecular Formula | C22H26Cl4N2O4S |
| Molecular Weight | 556.34 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | 2,4,5-trichloro-N-[3-(10,11-dimethoxy-5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)propyl]benzenesulfonamide;hydrochloride |
| SMILES | COc1cc2c3c(c1OC)CCC3N(CCCNS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl)CC2.Cl |
| InChI | InChI=1S/C22H25Cl3N2O4S.ClH/c1-30-19-10-13-6-9-27(18-5-4-14(21(13)18)22(19)31-2)8-3-7-26-32(28,29)20-12-16(24)15(23)11-17(20)25;/h10-12,18,26H,3-9H2,1-2H3;1H |
| InChIKey | NFYPKXRTPIZQRA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.34 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|