C21H24Cl2F2N2O2S — CID 67358603
N-[4-(5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)butyl]-5-chloro-2,4-difluorobenzenesulfonamide;hydrochloride (PubChem CID 67358603) has the molecular formula C21H24Cl2F2N2O2S and a molecular weight of 477.40 g/mol. Its IUPAC name is N-[4-(5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)butyl]-5-chloro-2,4-difluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-[4-(5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)butyl]-5-chloro-2,4-difluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 67358603 |
| Molecular Formula | C21H24Cl2F2N2O2S |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | N-[4-(5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-5-yl)butyl]-5-chloro-2,4-difluorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(NCCCCN1CCc2cccc3c2C1CC3)c1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C21H23ClF2N2O2S.ClH/c22-16-12-20(18(24)13-17(16)23)29(27,28)25-9-1-2-10-26-11-8-15-5-3-4-14-6-7-19(26)21(14)15;/h3-5,12-13,19,25H,1-2,6-11H2;1H |
| InChIKey | ASAOKXYTVHWQDQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|