C14H20Cl2N2O4S — CID 654841
2,5-dichloro-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide (PubChem CID 654841) has the molecular formula C14H20Cl2N2O4S and a molecular weight of 383.30 g/mol. Its IUPAC name is 2,5-dichloro-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 654841 |
| Molecular Formula | C14H20Cl2N2O4S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2,5-dichloro-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
| SMILES | COc1cc(Cl)c(S(=O)(=O)NCCCN2CCOCC2)cc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O4S/c1-21-13-9-12(16)14(10-11(13)15)23(19,20)17-3-2-4-18-5-7-22-8-6-18/h9-10,17H,2-8H2,1H3 |
| InChIKey | WJCQAPKONOFLCJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|