C17H28N2O4S — CID 16644712
4-ethoxy-2,3-dimethyl-N-(3-morpholin-4-ylpropyl)benzenesulfonamide (PubChem CID 16644712) has the molecular formula C17H28N2O4S and a molecular weight of 356.49 g/mol. Its IUPAC name is 4-ethoxy-2,3-dimethyl-N-(3-morpholin-4-ylpropyl)benzenesulfonamide.
| Compound Name | 4-ethoxy-2,3-dimethyl-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 16644712 |
| Molecular Formula | C17H28N2O4S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 4-ethoxy-2,3-dimethyl-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCCN2CCOCC2)c(C)c1C |
| InChI | InChI=1S/C17H28N2O4S/c1-4-23-16-6-7-17(15(3)14(16)2)24(20,21)18-8-5-9-19-10-12-22-13-11-19/h6-7,18H,4-5,8-13H2,1-3H3 |
| InChIKey | DBFUPXKVVIMURQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|