C15H19Cl2N3O2S — CID 22207456
4-chloro-N-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 22207456) has the molecular formula C15H19Cl2N3O2S and a molecular weight of 376.31 g/mol. Its IUPAC name is 4-chloro-N-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22207456 |
| Molecular Formula | C15H19Cl2N3O2S |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 4-chloro-N-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCn2ncc(Cl)c2C)c(C)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N3O2S/c1-10-8-15(11(2)7-13(10)16)23(21,22)19-5-4-6-20-12(3)14(17)9-18-20/h7-9,19H,4-6H2,1-3H3 |
| InChIKey | IGIIGSUZYPZLSG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|