C11H14ClN3O2S2 — CID 22207435
N-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]thiophene-2-sulfonamide (PubChem CID 22207435) has the molecular formula C11H14ClN3O2S2 and a molecular weight of 319.84 g/mol. Its IUPAC name is N-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22207435 |
| Molecular Formula | C11H14ClN3O2S2 |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N-[3-(4-chloro-5-methylpyrazol-1-yl)propyl]thiophene-2-sulfonamide |
| SMILES | Cc1c(Cl)cnn1CCCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C11H14ClN3O2S2/c1-9-10(12)8-13-15(9)6-3-5-14-19(16,17)11-4-2-7-18-11/h2,4,7-8,14H,3,5-6H2,1H3 |
| InChIKey | LPIMDTFTLKBJNL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|