C10H11N3O3S2 — CID 42226747
N-[2-(6-oxopyridazin-1-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 42226747) has the molecular formula C10H11N3O3S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[2-(6-oxopyridazin-1-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(6-oxopyridazin-1-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 42226747 |
| Molecular Formula | C10H11N3O3S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | N-[2-(6-oxopyridazin-1-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=c1cccnn1CCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C10H11N3O3S2/c14-9-3-1-5-11-13(9)7-6-12-18(15,16)10-4-2-8-17-10/h1-5,8,12H,6-7H2 |
| InChIKey | ZPJGUIYGMOHWJW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |