C23H33ClN2O2S — CID 68967870
N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-4-propan-2-ylbenzenesulfonamide;hydrochloride (PubChem CID 68967870) has the molecular formula C23H33ClN2O2S and a molecular weight of 437.05 g/mol. Its IUPAC name is N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-4-propan-2-ylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-4-propan-2-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 68967870 |
| Molecular Formula | C23H33ClN2O2S |
| Molecular Weight | 437.05 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-4-propan-2-ylbenzenesulfonamide;hydrochloride |
| SMILES | CC(C)c1ccc(S(=O)(=O)NCCCCCN2CCc3ccccc3C2)cc1.Cl |
| InChI | InChI=1S/C23H32N2O2S.ClH/c1-19(2)20-10-12-23(13-11-20)28(26,27)24-15-6-3-7-16-25-17-14-21-8-4-5-9-22(21)18-25;/h4-5,8-13,19,24H,3,6-7,14-18H2,1-2H3;1H |
| InChIKey | IWYYXPFHUFYYGK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.05 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|