C23H31N3O2S — CID 123271986
N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide (PubChem CID 123271986) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide.
| Compound Name | N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 123271986 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide |
| SMILES | O=S(=O)(NCCCCCN1CCc2ccccc2C1)c1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C23H31N3O2S/c27-29(28,23-9-8-20-10-13-24-17-22(20)16-23)25-12-4-1-5-14-26-15-11-19-6-2-3-7-21(19)18-26/h2-3,6-9,16,24-25H,1,4-5,10-15,17-18H2 |
| InChIKey | WQORDBXEVBSIMB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|