C20H23F3N2O2S — CID 21092268
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 21092268) has the molecular formula C20H23F3N2O2S and a molecular weight of 412.48 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 21092268 |
| Molecular Formula | C20H23F3N2O2S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCN1CCc2ccccc2C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H23F3N2O2S/c21-20(22,23)18-8-5-9-19(14-18)28(26,27)24-11-3-4-12-25-13-10-16-6-1-2-7-17(16)15-25/h1-2,5-9,14,24H,3-4,10-13,15H2 |
| InChIKey | NQDWEVZGUUSYQT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|